ChemNet > CAS > 3541-37-5 Benzo[b]thiophene-2-carboxaldehyde
3541-37-5 Benzo[b]thiophene-2-carboxaldehyde
نام محصول |
Benzo[b]thiophene-2-carboxaldehyde |
نام انگلیسی |
Benzo[b]thiophene-2-carboxaldehyde; 2-Formylbenzo[b]thiophene; Thianaphthene-2-carboxaldehyde; 1-Benzothiophene-2-carbaldehyde; Benzo[b]thiophene-2-carbaldehyde |
میدان مغناطیسی |
C9H6OS |
وزن مولکولی |
162.2083 |
InChI |
InChI=1/C9H6OS/c10-6-8-5-7-3-1-2-4-9(7)11-8/h1-6H |
شماره سیایاس |
3541-37-5 |
ساختار مولکولی |
|
تراکم |
1.3g/cm3 |
نقطه ذوب |
32-36℃ |
نقطه غلیان |
303.2°C at 760 mmHg |
ضریب شکست |
1.719 |
نقطه اشتعال |
137.2°C |
فشار بخار |
0.000944mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S22:;
S24/25:;
|
|